Products 50912-65-7

CAS 50912-65-7 is the registry number for 2-(2,4-Dimethylphenoxy)ethanamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g.

Structural formula: {0} (CAS {1})

2-(2,4-dimethylphenoxy)ethanamine (CAS 50912-65-7) is a chemical compound with the molecular formula C10H15NO and a molecular weight of 165.23 g/mol. IUPAC name: 2-(2,4-dimethylphenoxy)ethanamine. InChIKey: WTMWXJLUFMRFBV-UHFFFAOYSA-N.

Identity
Molecular formulaC10H15NO
Molecular weight165.23 g/mol
IUPAC name2-(2,4-dimethylphenoxy)ethanamine
InChIKeyWTMWXJLUFMRFBV-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1)OCCN)C

Computed by PubChem (NCBI)