Products 5096-21-9
CAS 5096-21-9 is the registry number for N-mesitylacetamide, 95%. Offered by: Chemat. Available pack sizes: 1g.
N-(2,4,6-trimethylphenyl)acetamide (CAS 5096-21-9) is a chemical compound with the molecular formula C11H15NO and a molecular weight of 177.24 g/mol. IUPAC name: N-(2,4,6-trimethylphenyl)acetamide. InChIKey: LQWWZVZGPVVZOB-UHFFFAOYSA-N.
| Molecular formula | C11H15NO |
|---|---|
| Molecular weight | 177.24 g/mol |
| IUPAC name | N-(2,4,6-trimethylphenyl)acetamide |
| InChIKey | LQWWZVZGPVVZOB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)NC(=O)C)C |
Computed by PubChem (NCBI)
Synonyms:
N-mesitylacetamide, N-(2,4,6-Trimethylphenyl)acetamide, Acetamide, N-(2,4,6-trimethylphenyl)-, N-[2,4,6-trimethylphenyl]acetamide, Acetamide, N-(2,4,6-trimethylphenyl)-(9CI), Acetomesidide, 2,4,6-Trimethylacetanilide, 2,6-Trimethylacetanilide, Acetamide, N-(2,4,6-trimethylphenyl)- (9CI), 2',6'-Trimethylacetanilide