CAS 50977-75-8 is the registry number for Disodium 5-methylisophthalate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
Disodium;5-methylbenzene-1,3-dicarboxylate (CAS 50977-75-8) is a chemical compound with the molecular formula C9H6Na2O4 and a molecular weight of 224.12 g/mol. IUPAC name: disodium;5-methylbenzene-1,3-dicarboxylate. InChIKey: PYOMABPBBGNPCT-UHFFFAOYSA-L.
| Molecular formula | C9H6Na2O4 |
|---|---|
| Molecular weight | 224.12 g/mol |
| IUPAC name | disodium;5-methylbenzene-1,3-dicarboxylate |
| InChIKey | PYOMABPBBGNPCT-UHFFFAOYSA-L |
| SMILES | CC1=CC(=CC(=C1)C(=O)[O-])C(=O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)