CAS 5099-23-0 appears in our catalog under these names: N1-[2-(diethylamino)ethyl]-4-nitrobenzene-1,2-diamine hydrochloride, 95%, 95%, N1-(2-(Diethylamino)ethyl)-4-nitrobenzene-1,2-diamine hydrochloride, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
1-N-[2-(diethylamino)ethyl]-4-nitrobenzene-1,2-diamine;hydrochloride (CAS 5099-23-0) is a chemical compound with the molecular formula C12H21ClN4O2 and a molecular weight of 288.77 g/mol. IUPAC name: 1-N-[2-(diethylamino)ethyl]-4-nitrobenzene-1,2-diamine;hydrochloride. InChIKey: MZFXBTUYZWBSOZ-UHFFFAOYSA-N.
| Molecular formula | C12H21ClN4O2 |
|---|---|
| Molecular weight | 288.77 g/mol |
| IUPAC name | 1-N-[2-(diethylamino)ethyl]-4-nitrobenzene-1,2-diamine;hydrochloride |
| InChIKey | MZFXBTUYZWBSOZ-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCNC1=C(C=C(C=C1)[N+](=O)[O-])N.Cl |
Computed by PubChem (NCBI)