CAS 5099-39-8 appears in our catalog under these names: N1-(2-(Diethylamino)ethyl)-4-nitro-1,2-benzenediamine, >95% (HPLC), N1-(2-(Diethylamino)ethyl)-4-nitro-1,2-benzenediamine, N1-[2-(diethylamino)ethyl]-4-nitrobenzene-1,2-diamine, 95%, 95%. Offered by: TRC, Biosynth, Chemat. Available pack sizes: 100mg, 10mg, 25mg, 1g, 250mg, 5g.
1-N-[2-(diethylamino)ethyl]-4-nitrobenzene-1,2-diamine (CAS 5099-39-8) is a chemical compound with the molecular formula C12H20N4O2 and a molecular weight of 252.31 g/mol. IUPAC name: 1-N-[2-(diethylamino)ethyl]-4-nitrobenzene-1,2-diamine. InChIKey: PDMRSMIOJCKMCF-UHFFFAOYSA-N.
| Molecular formula | C12H20N4O2 |
|---|---|
| Molecular weight | 252.31 g/mol |
| IUPAC name | 1-N-[2-(diethylamino)ethyl]-4-nitrobenzene-1,2-diamine |
| InChIKey | PDMRSMIOJCKMCF-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCNC1=C(C=C(C=C1)[N+](=O)[O-])N |
Computed by PubChem (NCBI)