Products 50990-93-7

CAS 50990-93-7 appears in our catalog under these names: 2,5-Dimethylfuran-3-carbonyl chloride, 97%, 2,5-Dimethylfuran-3-carbonyl chloride, 98%, 2,5–Dimethyl–3–furoyl Chloride, 2,5-Dimethylfuran-3-carbonyl chloride, 97% , 2,5-Dimethyl-furan-3-carbonyl chloride. Offered by: Combi-blocks, AmBeed, GLPBio, Thermo Scientific, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2,5-dimethylfuran-3-carbonyl chloride (CAS 50990-93-7) is a chemical compound with the molecular formula C7H7ClO2 and a molecular weight of 158.58 g/mol. IUPAC name: 2,5-dimethylfuran-3-carbonyl chloride. InChIKey: RWORXZHVOUPMMM-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7ClO2
Molecular weight158.58 g/mol
IUPAC name2,5-dimethylfuran-3-carbonyl chloride
InChIKeyRWORXZHVOUPMMM-UHFFFAOYSA-N
SMILESCC1=CC(=C(O1)C)C(=O)Cl

Computed by PubChem (NCBI)