CAS 51012-29-4 appears in our catalog under these names: 2-(4-Bromobenzenesulfonamido)benzoic acid, 2-(4-Bromobenzenesulfonamido)benzoic acid, 97%, 2-(4-Bromo-benzenesulfonylamino)-benzoic acid, 97%, 97%. Offered by: Biosynth, Fluorochem, Chemat. Available pack sizes: 100mg, 1g, 50mg, 250mg, 500mg, 2.5g.
2-[(4-bromophenyl)sulfonylamino]benzoic acid (CAS 51012-29-4) is a chemical compound with the molecular formula C13H10BrNO4S and a molecular weight of 356.19 g/mol. IUPAC name: 2-[(4-bromophenyl)sulfonylamino]benzoic acid. InChIKey: RPCZXFGZZGTKIV-UHFFFAOYSA-N.
| Molecular formula | C13H10BrNO4S |
|---|---|
| Molecular weight | 356.19 g/mol |
| IUPAC name | 2-[(4-bromophenyl)sulfonylamino]benzoic acid |
| InChIKey | RPCZXFGZZGTKIV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)NS(=O)(=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)