CAS 5103-42-4 appears in our catalog under these names: Hydrindantin, 95%, Hydrindantin 98%, 2,2'-Dihydroxy-1H,1'H-[2,2'-biindene]-1,1',3,3'(2H,2'H)-tetraone, 98%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 5g, 25g, 1g, 100g, 250mg, 10g.
2-hydroxy-2-(2-hydroxy-1,3-dioxoinden-2-yl)indene-1,3-dione (CAS 5103-42-4) is a chemical compound with the molecular formula C18H10O6 and a molecular weight of 322.3 g/mol. IUPAC name: 2-hydroxy-2-(2-hydroxy-1,3-dioxoinden-2-yl)indene-1,3-dione. InChIKey: LWFPYLZOVOCBPZ-UHFFFAOYSA-N.
| Molecular formula | C18H10O6 |
|---|---|
| Molecular weight | 322.3 g/mol |
| IUPAC name | 2-hydroxy-2-(2-hydroxy-1,3-dioxoinden-2-yl)indene-1,3-dione |
| InChIKey | LWFPYLZOVOCBPZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C(C2=O)(C3(C(=O)C4=CC=CC=C4C3=O)O)O |
Computed by PubChem (NCBI)