CAS 510725-35-6 is the registry number for 1-(3-(Trifluoromethyl)benzyl)piperazine hydrochloride. Offered by: Biosynth. Available pack sizes: 500mg, 250mg.
1-[[3-(trifluoromethyl)phenyl]methyl]piperazine;hydrochloride (CAS 510725-35-6) is a chemical compound with the molecular formula C12H16ClF3N2 and a molecular weight of 280.72 g/mol. IUPAC name: 1-[[3-(trifluoromethyl)phenyl]methyl]piperazine;hydrochloride. InChIKey: GVOKACNFIJZZFQ-UHFFFAOYSA-N.
| Molecular formula | C12H16ClF3N2 |
|---|---|
| Molecular weight | 280.72 g/mol |
| IUPAC name | 1-[[3-(trifluoromethyl)phenyl]methyl]piperazine;hydrochloride |
| InChIKey | GVOKACNFIJZZFQ-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)CC2=CC(=CC=C2)C(F)(F)F.Cl |
Computed by PubChem (NCBI)