CAS 51073-14-4 appears in our catalog under these names: Benzbromarone Impurity 15, 1-(3,5-Dibromo-4-hydroxyphenyl)-2-(2-hydroxyphenyl)ethanone. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 5mg.
1-(3,5-dibromo-4-hydroxyphenyl)-2-(2-hydroxyphenyl)ethanone (CAS 51073-14-4) is a chemical compound with the molecular formula C14H10Br2O3 and a molecular weight of 386.03 g/mol. IUPAC name: 1-(3,5-dibromo-4-hydroxyphenyl)-2-(2-hydroxyphenyl)ethanone. InChIKey: YYXRJJCCYYGLMA-UHFFFAOYSA-N.
| Molecular formula | C14H10Br2O3 |
|---|---|
| Molecular weight | 386.03 g/mol |
| IUPAC name | 1-(3,5-dibromo-4-hydroxyphenyl)-2-(2-hydroxyphenyl)ethanone |
| InChIKey | YYXRJJCCYYGLMA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(=O)C2=CC(=C(C(=C2)Br)O)Br)O |
Computed by PubChem (NCBI)