CAS 510738-34-8 is the registry number for 4-(2,6-Difluorophenyl)-1,3-thiazol-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
4-(2,6-difluorophenyl)-1,3-thiazol-2-amine (CAS 510738-34-8) is a chemical compound with the molecular formula C9H6F2N2S and a molecular weight of 212.22 g/mol. IUPAC name: 4-(2,6-difluorophenyl)-1,3-thiazol-2-amine. InChIKey: ZRFCBSGOMCOUJG-UHFFFAOYSA-N.
| Molecular formula | C9H6F2N2S |
|---|---|
| Molecular weight | 212.22 g/mol |
| IUPAC name | 4-(2,6-difluorophenyl)-1,3-thiazol-2-amine |
| InChIKey | ZRFCBSGOMCOUJG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C2=CSC(=N2)N)F |
Computed by PubChem (NCBI)