CAS 510758-23-3 appears in our catalog under these names: FAM azide, 5-isomer, 95%, FAM azide, 5-isomer 95%, FAM azide, 5-isomer, 95%, 95%, FAM azide, 5-isomer, 97.42%. Offered by: Lumiprobe, Ambeed, Chemat, MedChemExpress. Available pack sizes: 100ul, 10 mM/DMSO, 500ul, 10 mM/DMSO, 1ml, 10 mM/DMSO, 1mg, 5mg, 10mg, 25mg, 50mg.
N-(3-azidopropyl)-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxamide (CAS 510758-23-3) is a chemical compound with the molecular formula C24H18N4O6 and a molecular weight of 458.4 g/mol. IUPAC name: N-(3-azidopropyl)-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxamide. InChIKey: FJQLLGFUUOOYKS-UHFFFAOYSA-N.
| Molecular formula | C24H18N4O6 |
|---|---|
| Molecular weight | 458.4 g/mol |
| IUPAC name | N-(3-azidopropyl)-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxamide |
| InChIKey | FJQLLGFUUOOYKS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)NCCCN=[N+]=[N-])C(=O)OC23C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O |
Computed by PubChem (NCBI)