CAS 510763-41-4 is the registry number for 3,3-Dimethyl-N-(4-((4-methylpiperidin-1-yl)sulfonyl)phenyl)butanamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3,3-dimethyl-N-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]butanamide (CAS 510763-41-4) is a chemical compound with the molecular formula C18H28N2O3S and a molecular weight of 352.5 g/mol. IUPAC name: 3,3-dimethyl-N-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]butanamide. InChIKey: MVSWDVFVQUJMKP-UHFFFAOYSA-N.
| Molecular formula | C18H28N2O3S |
|---|---|
| Molecular weight | 352.5 g/mol |
| IUPAC name | 3,3-dimethyl-N-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]butanamide |
| InChIKey | MVSWDVFVQUJMKP-UHFFFAOYSA-N |
| SMILES | CC1CCN(CC1)S(=O)(=O)C2=CC=C(C=C2)NC(=O)CC(C)(C)C |
Computed by PubChem (NCBI)