CAS 5111-66-0 appears in our catalog under these names: Naproxen EP Impurity H, 6-Methoxy-2-naphthol, >95% (HPLC), 6-Methoxynaphthalen-2-ol (Hydroxynerolin), 6–Methoxy–2–naphthol, 6-Methoxy-2-naphthol. Offered by: Chemat Brand, TRC, Mikromol, GLPBio, Biosynth. Available pack sizes: on request, 10g, 1g, 5g, 25mg, 100mg, 25g, 50g.
6-methoxynaphthalen-2-ol (CAS 5111-66-0) is a chemical compound with the molecular formula C11H10O2 and a molecular weight of 174.20 g/mol. IUPAC name: 6-methoxynaphthalen-2-ol. InChIKey: WWPKRXOOVICNJY-UHFFFAOYSA-N.
| Molecular formula | C11H10O2 |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | 6-methoxynaphthalen-2-ol |
| InChIKey | WWPKRXOOVICNJY-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C=C(C=C2)O |
Computed by PubChem (NCBI)