CAS 5111-73-9 is the registry number for 1,4-dihydro-Naphthoic Acid. Offered by: Chemat Brand. Available pack sizes: on request.
1,4-dihydronaphthalene-1-carboxylic acid (CAS 5111-73-9) is a chemical compound with the molecular formula C11H10O2 and a molecular weight of 174.20 g/mol. IUPAC name: 1,4-dihydronaphthalene-1-carboxylic acid. InChIKey: LSCVQHLQUUOXGK-UHFFFAOYSA-N.
| Molecular formula | C11H10O2 |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | 1,4-dihydronaphthalene-1-carboxylic acid |
| InChIKey | LSCVQHLQUUOXGK-UHFFFAOYSA-N |
| SMILES | C1C=CC(C2=CC=CC=C21)C(=O)O |
Computed by PubChem (NCBI)