Products 5111-73-9

CAS 5111-73-9 is the registry number for 1,4-dihydro-Naphthoic Acid. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1,4-dihydronaphthalene-1-carboxylic acid (CAS 5111-73-9) is a chemical compound with the molecular formula C11H10O2 and a molecular weight of 174.20 g/mol. IUPAC name: 1,4-dihydronaphthalene-1-carboxylic acid. InChIKey: LSCVQHLQUUOXGK-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10O2
Molecular weight174.20 g/mol
IUPAC name1,4-dihydronaphthalene-1-carboxylic acid
InChIKeyLSCVQHLQUUOXGK-UHFFFAOYSA-N
SMILESC1C=CC(C2=CC=CC=C21)C(=O)O

Computed by PubChem (NCBI)