CAS 51114-12-6 is the registry number for 1,4-bis(heptafluoropropan-2-yl)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1,4-bis(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzene (CAS 51114-12-6) is a chemical compound with the molecular formula C12H4F14 and a molecular weight of 414.14 g/mol. IUPAC name: 1,4-bis(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzene. InChIKey: BPGZBMINTWQDOH-UHFFFAOYSA-N.
| Molecular formula | C12H4F14 |
|---|---|
| Molecular weight | 414.14 g/mol |
| IUPAC name | 1,4-bis(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzene |
| InChIKey | BPGZBMINTWQDOH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(F)(F)F)(C(F)(F)F)F)C(C(F)(F)F)(C(F)(F)F)F |
Computed by PubChem (NCBI)