CAS 5113-93-9 is the registry number for (3S,6R)-3-Isopropyl-6-methylcyclohexene. Offered by: Biosynth. Available pack sizes: 0,05g.
(+)-trans-2-menthene is a chiral monoterpene consisting of cyclohexene having isopropyl and methyl substitents at the 3- and 6-positions respectively. It is a cycloalkene and a monoterpene. It derives from a hydride of a p-menthane.
Source: ChEBI
| Molecular formula | C10H18 |
|---|---|
| Molecular weight | 138.25 g/mol |
| IUPAC name | (3R,6S)-3-methyl-6-propan-2-ylcyclohexene |
| InChIKey | WHNGPXQYYRWQAS-UWVGGRQHSA-N |
| SMILES | C[C@@H]1CC[C@H](C=C1)C(C)C |
Computed by PubChem (NCBI)