CAS 51152-12-6 is the registry number for (-)-cis-Myrtanol. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(1S,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methanol (CAS 51152-12-6) is a chemical compound with the molecular formula C10H18O and a molecular weight of 154.25 g/mol. IUPAC name: [(1S,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methanol. InChIKey: LDWAIHWGMRVEFR-CIUDSAMLSA-N.
| Molecular formula | C10H18O |
|---|---|
| Molecular weight | 154.25 g/mol |
| IUPAC name | [(1S,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methanol |
| InChIKey | LDWAIHWGMRVEFR-CIUDSAMLSA-N |
| SMILES | CC1([C@H]2CC[C@H]([C@@H]1C2)CO)C |
Computed by PubChem (NCBI)