CAS 51153-69-6 is the registry number for Rel-(2R,5R)-2,5-dimethylpiperidin-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,5R)-2,5-dimethylpiperidin-4-one (CAS 51153-69-6) is a chemical compound with the molecular formula C7H13NO and a molecular weight of 127.18 g/mol. IUPAC name: (2R,5R)-2,5-dimethylpiperidin-4-one. InChIKey: KZAGJHDAWXVDQX-PHDIDXHHSA-N.
| Molecular formula | C7H13NO |
|---|---|
| Molecular weight | 127.18 g/mol |
| IUPAC name | (2R,5R)-2,5-dimethylpiperidin-4-one |
| InChIKey | KZAGJHDAWXVDQX-PHDIDXHHSA-N |
| SMILES | C[C@@H]1CC(=O)[C@@H](CN1)C |
Computed by PubChem (NCBI)