Products 5119-24-4
CAS 5119-24-4 is the registry number for Allantoin galacturonic acid. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2,5-dioxoimidazolidin-4-yl)urea;(2S,3R,4S,5R)-3,4,5,6-tetrahydroxyoxane-2-carboxylic acid (CAS 5119-24-4) is a chemical compound with the molecular formula C10H16N4O10 and a molecular weight of 352.26 g/mol. IUPAC name: (2,5-dioxoimidazolidin-4-yl)urea;(2S,3R,4S,5R)-3,4,5,6-tetrahydroxyoxane-2-carboxylic acid. InChIKey: DCFWIZFONLVPKL-KSSASCOMSA-N.
| Molecular formula | C10H16N4O10 |
|---|---|
| Molecular weight | 352.26 g/mol |
| IUPAC name | (2,5-dioxoimidazolidin-4-yl)urea;(2S,3R,4S,5R)-3,4,5,6-tetrahydroxyoxane-2-carboxylic acid |
| InChIKey | DCFWIZFONLVPKL-KSSASCOMSA-N |
| SMILES | [C@@H]1([C@H]([C@H](OC([C@@H]1O)O)C(=O)O)O)O.C1(C(=O)NC(=O)N1)NC(=O)N |
Computed by PubChem (NCBI)