CAS 512-35-6 appears in our catalog under these names: Benzenesulfonic anhydride, 96%, Benzenesulfonic anhydride, 98%, Benzenesulfonic Anhydride, Benzenesulfonic Anhydride, >96.0%(T), Benzenesulfonic Anhydride, 96%, 96%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 1g, 10g, 5g, 25g.
Benzenesulfonyl benzenesulfonate (CAS 512-35-6) is a chemical compound with the molecular formula C12H10O5S2 and a molecular weight of 298.3 g/mol. IUPAC name: benzenesulfonyl benzenesulfonate. InChIKey: MLWPJXZKQOPTKZ-UHFFFAOYSA-N.
| Molecular formula | C12H10O5S2 |
|---|---|
| Molecular weight | 298.3 g/mol |
| IUPAC name | benzenesulfonyl benzenesulfonate |
| InChIKey | MLWPJXZKQOPTKZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)OS(=O)(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)