CAS 512177-31-0 is the registry number for CCR2-RA. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-acetyl-1-(4-chloro-2-fluorophenyl)-2-cyclohexyl-4-hydroxy-2H-pyrrol-5-one (CAS 512177-31-0) is a chemical compound with the molecular formula C18H19ClFNO3 and a molecular weight of 351.8 g/mol. IUPAC name: 3-acetyl-1-(4-chloro-2-fluorophenyl)-2-cyclohexyl-4-hydroxy-2H-pyrrol-5-one. InChIKey: VQNLJXWZGVRLBA-UHFFFAOYSA-N.
| Molecular formula | C18H19ClFNO3 |
|---|---|
| Molecular weight | 351.8 g/mol |
| IUPAC name | 3-acetyl-1-(4-chloro-2-fluorophenyl)-2-cyclohexyl-4-hydroxy-2H-pyrrol-5-one |
| InChIKey | VQNLJXWZGVRLBA-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C(=O)N(C1C2CCCCC2)C3=C(C=C(C=C3)Cl)F)O |
Computed by PubChem (NCBI)