Products 51219-88-6
CAS 51219-88-6 appears in our catalog under these names: Tetramethylene-d8 Sulfone, 98 atom % D, min 98% Chemical Purity, Sulfolane-d8, >95% (GC), 1,1-Dioxothiolan-d8, 99.9%. Offered by: CDN, TRC, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 100mg, 10mg, 25mg, 5 mg.
2,2,3,3,4,4,5,5-octadeuteriothiolane 1,1-dioxide (CAS 51219-88-6) is a chemical compound with the molecular formula C4H8O2S and a molecular weight of 128.22 g/mol. IUPAC name: 2,2,3,3,4,4,5,5-octadeuteriothiolane 1,1-dioxide. InChIKey: HXJUTPCZVOIRIF-SVYQBANQSA-N.
| Molecular formula | C4H8O2S |
|---|---|
| Molecular weight | 128.22 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5-octadeuteriothiolane 1,1-dioxide |
| InChIKey | HXJUTPCZVOIRIF-SVYQBANQSA-N |
| SMILES | [2H]C1(C(C(S(=O)(=O)C1([2H])[2H])([2H])[2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)