Products 51219-89-7
CAS 51219-89-7 appears in our catalog under these names: Tetramethyl-d12-urea, 99 atom % D, min 98% Chemical Purity, 1,1,3,3–Tetramethylurea–d12, 1,1,3,3-Tetramethylurea-d12, 98.17%. Offered by: CDN, GLPBio, MedChemExpress. Available pack sizes: 0,1g, 0,05g, 1mg, 10mg, 5mg, 5 mg, 50 mg, 10 mg.
1,1,3,3-tetrakis(trideuteriomethyl)urea (CAS 51219-89-7) is a chemical compound with the molecular formula C5H12N2O and a molecular weight of 128.24 g/mol. IUPAC name: 1,1,3,3-tetrakis(trideuteriomethyl)urea. InChIKey: AVQQQNCBBIEMEU-MGKWXGLJSA-N.
| Molecular formula | C5H12N2O |
|---|---|
| Molecular weight | 128.24 g/mol |
| IUPAC name | 1,1,3,3-tetrakis(trideuteriomethyl)urea |
| InChIKey | AVQQQNCBBIEMEU-MGKWXGLJSA-N |
| SMILES | [2H]C([2H])([2H])N(C(=O)N(C([2H])([2H])[2H])C([2H])([2H])[2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)