CAS 5122-20-3 appears in our catalog under these names: 5-(tert-Butyl)-2-iodo-1,3-dimethylbenzene, 98%, 5-tert-Butyl-2-iodo-1,3-dimethylbenzene, 97% , 5-(tert-Butyl)-2-iodo-1,3-dimethylbenzene 98%, 5-(tert-Butyl)-2-iodo-1,3-dimethylbenzene, 97%, 97%, 5-(tert-Butyl)-2-iodo-1,3-dimethylbenzene. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg, 10g.
5-tert-butyl-2-iodo-1,3-dimethylbenzene (CAS 5122-20-3) is a chemical compound with the molecular formula C12H17I and a molecular weight of 288.17 g/mol. IUPAC name: 5-tert-butyl-2-iodo-1,3-dimethylbenzene. InChIKey: SCKWYPTZVFBKKW-UHFFFAOYSA-N.
| Molecular formula | C12H17I |
|---|---|
| Molecular weight | 288.17 g/mol |
| IUPAC name | 5-tert-butyl-2-iodo-1,3-dimethylbenzene |
| InChIKey | SCKWYPTZVFBKKW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1I)C)C(C)(C)C |
Computed by PubChem (NCBI)