CAS 5123-42-2 appears in our catalog under these names: H-Ala-gly-gly-gly-oh, 95%, H-ALA-GLY-GLY-GLY-OH. Offered by: Combi-blocks, TRC. Available pack sizes: 250mg, 100mg, 500mg.
2-[[2-[[2-[[(2S)-2-aminopropanoyl]amino]acetyl]amino]acetyl]amino]acetic acid (CAS 5123-42-2) is a chemical compound with the molecular formula C9H16N4O5 and a molecular weight of 260.25 g/mol. IUPAC name: 2-[[2-[[2-[[(2S)-2-aminopropanoyl]amino]acetyl]amino]acetyl]amino]acetic acid. InChIKey: KEULKIZRPKJGIH-YFKPBYRVSA-N.
| Molecular formula | C9H16N4O5 |
|---|---|
| Molecular weight | 260.25 g/mol |
| IUPAC name | 2-[[2-[[2-[[(2S)-2-aminopropanoyl]amino]acetyl]amino]acetyl]amino]acetic acid |
| InChIKey | KEULKIZRPKJGIH-YFKPBYRVSA-N |
| SMILES | C[C@@H](C(=O)NCC(=O)NCC(=O)NCC(=O)O)N |
Computed by PubChem (NCBI)