CAS 51236-40-9 appears in our catalog under these names: N-Acetyl-1-chloro-3,4,6-tri-o-acetyl-glucosaminide, 95%, 2-Acetamido-3,4,6-tri-O-acetyl-2-deoxy-D-glucopyranosyl chloride - Stabilised with 2% CaCO3. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g, 25g.
[(2R,3S,4R,5R)-5-acetamido-3,4-diacetyloxy-6-chlorooxan-2-yl]methyl acetate (CAS 51236-40-9) is a chemical compound with the molecular formula C14H20ClNO8 and a molecular weight of 365.76 g/mol. IUPAC name: [(2R,3S,4R,5R)-5-acetamido-3,4-diacetyloxy-6-chlorooxan-2-yl]methyl acetate. InChIKey: NAYYKQAWUWXLPD-GNMOMJPPSA-N.
| Molecular formula | C14H20ClNO8 |
|---|---|
| Molecular weight | 365.76 g/mol |
| IUPAC name | [(2R,3S,4R,5R)-5-acetamido-3,4-diacetyloxy-6-chlorooxan-2-yl]methyl acetate |
| InChIKey | NAYYKQAWUWXLPD-GNMOMJPPSA-N |
| SMILES | CC(=O)N[C@@H]1[C@H]([C@@H]([C@H](OC1Cl)COC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)