Products 5124-09-4

CAS 5124-09-4 appears in our catalog under these names: 5-Amino-3-methyl-1,2,3-oxadiazolium, inner salt hydrochloride, 95%, 5-Amino-3-methyl-1,2,3-oxadiazol-3-ium chloride, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g.

Structural formula: {0} (CAS {1})

3-methyloxadiazol-3-ium-5-amine chloride (CAS 5124-09-4) is a chemical compound with the molecular formula C3H6ClN3O and a molecular weight of 135.55 g/mol. IUPAC name: 3-methyloxadiazol-3-ium-5-amine chloride. InChIKey: IXRXQWQAFZCXJW-UHFFFAOYSA-M.

Identity
Molecular formulaC3H6ClN3O
Molecular weight135.55 g/mol
IUPAC name3-methyloxadiazol-3-ium-5-amine chloride
InChIKeyIXRXQWQAFZCXJW-UHFFFAOYSA-M
SMILESC[N+]1=NOC(=C1)N.[Cl-]

Computed by PubChem (NCBI)