CAS 51246-91-4 is the registry number for 1,5-Anhydro-β-D-xylofuranose. Offered by: Chemat. Available pack sizes: 100mg, 10mg, 25mg, 50mg.
(1R,4R,5R,6R)-2,7-dioxabicyclo[2.2.1]heptane-5,6-diol (CAS 51246-91-4) is a chemical compound with the molecular formula C5H8O4 and a molecular weight of 132.11 g/mol. IUPAC name: (1R,4R,5R,6R)-2,7-dioxabicyclo[2.2.1]heptane-5,6-diol. InChIKey: OYJJPEGOLXZHDM-KKQCNMDGSA-N.
| Molecular formula | C5H8O4 |
|---|---|
| Molecular weight | 132.11 g/mol |
| IUPAC name | (1R,4R,5R,6R)-2,7-dioxabicyclo[2.2.1]heptane-5,6-diol |
| InChIKey | OYJJPEGOLXZHDM-KKQCNMDGSA-N |
| SMILES | C1[C@@H]2[C@@H]([C@H]([C@H](O1)O2)O)O |
Computed by PubChem (NCBI)