CAS 51248-22-7 is the registry number for 1,1,2,2-Tetra-2-thienyl-1,2-ethanediol. Offered by: TRC. Available pack sizes: 100mg.
1,1,2,2-tetrathiophen-2-ylethane-1,2-diol (CAS 51248-22-7) is a chemical compound with the molecular formula C18H14O2S4 and a molecular weight of 390.6 g/mol. IUPAC name: 1,1,2,2-tetrathiophen-2-ylethane-1,2-diol. InChIKey: VVOGXYRHGQVGHL-UHFFFAOYSA-N.
| Molecular formula | C18H14O2S4 |
|---|---|
| Molecular weight | 390.6 g/mol |
| IUPAC name | 1,1,2,2-tetrathiophen-2-ylethane-1,2-diol |
| InChIKey | VVOGXYRHGQVGHL-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C(C2=CC=CS2)(C(C3=CC=CS3)(C4=CC=CS4)O)O |
Computed by PubChem (NCBI)