CAS 51249-63-9 is the registry number for 1,2-Dibromo-1H,1H,2H-perfluorodecane. Offered by: TRC. Available pack sizes: 250mg.
9,10-dibromo-1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluorodecane (CAS 51249-63-9) is a chemical compound with the molecular formula C10H3Br2F17 and a molecular weight of 605.91 g/mol. IUPAC name: 9,10-dibromo-1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluorodecane. InChIKey: ZYFLRTOFRKYGGJ-UHFFFAOYSA-N.
| Molecular formula | C10H3Br2F17 |
|---|---|
| Molecular weight | 605.91 g/mol |
| IUPAC name | 9,10-dibromo-1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluorodecane |
| InChIKey | ZYFLRTOFRKYGGJ-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)Br)Br |
Computed by PubChem (NCBI)