CAS 51270-90-7 appears in our catalog under these names: 2-(1-Chloroethyl)-1,3,5-trimethylbenzene, 95%, 2-(1-Chloroethyl)-1,3,5-trimethylbenzene. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
2-(1-chloroethyl)-1,3,5-trimethylbenzene (CAS 51270-90-7) is a chemical compound with the molecular formula C11H15Cl and a molecular weight of 182.69 g/mol. IUPAC name: 2-(1-chloroethyl)-1,3,5-trimethylbenzene. InChIKey: TXQDZFRXFDSOIO-UHFFFAOYSA-N.
| Molecular formula | C11H15Cl |
|---|---|
| Molecular weight | 182.69 g/mol |
| IUPAC name | 2-(1-chloroethyl)-1,3,5-trimethylbenzene |
| InChIKey | TXQDZFRXFDSOIO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C(C)Cl)C |
Computed by PubChem (NCBI)