CAS 512776-93-1 is the registry number for Methyl 3-(4-Fluorophenyl)sulfonyl-2-hydroxy-2-methylpropanoate. Offered by: Mikromol. Available pack sizes: 25mg.
Methyl 3-(4-fluorophenyl)sulfonyl-2-hydroxy-2-methylpropanoate (CAS 512776-93-1) is a chemical compound with the molecular formula C11H13FO5S and a molecular weight of 276.28 g/mol. IUPAC name: methyl 3-(4-fluorophenyl)sulfonyl-2-hydroxy-2-methylpropanoate. InChIKey: KCKSHSGPFNASCJ-UHFFFAOYSA-N.
| Molecular formula | C11H13FO5S |
|---|---|
| Molecular weight | 276.28 g/mol |
| IUPAC name | methyl 3-(4-fluorophenyl)sulfonyl-2-hydroxy-2-methylpropanoate |
| InChIKey | KCKSHSGPFNASCJ-UHFFFAOYSA-N |
| SMILES | CC(CS(=O)(=O)C1=CC=C(C=C1)F)(C(=O)OC)O |
Computed by PubChem (NCBI)