CAS 512787-44-9 appears in our catalog under these names: 1-(4-Isopropylbenzyl)-5-nitro-1H-indole, 95%, 1–(4–isopropylbenzyl)–5–nitro–1H–indole. Offered by: AmBeed, GLPBio. Available pack sizes: 250mg, 100mg.
5-nitro-1-[(4-propan-2-ylphenyl)methyl]indole (CAS 512787-44-9) is a chemical compound with the molecular formula C18H18N2O2 and a molecular weight of 294.3 g/mol. IUPAC name: 5-nitro-1-[(4-propan-2-ylphenyl)methyl]indole. InChIKey: OFIDYVJJAWZWMC-UHFFFAOYSA-N.
| Molecular formula | C18H18N2O2 |
|---|---|
| Molecular weight | 294.3 g/mol |
| IUPAC name | 5-nitro-1-[(4-propan-2-ylphenyl)methyl]indole |
| InChIKey | OFIDYVJJAWZWMC-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)CN2C=CC3=C2C=CC(=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)