Products 512795-91-4
CAS 512795-91-4 is the registry number for N-(4-fluorophenyl)-1-phenylcyclopentane-1-carboxamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-(4-fluorophenyl)-1-phenylcyclopentane-1-carboxamide (CAS 512795-91-4) is a chemical compound with the molecular formula C18H18FNO and a molecular weight of 283.3 g/mol. IUPAC name: N-(4-fluorophenyl)-1-phenylcyclopentane-1-carboxamide. InChIKey: QWPHKKNXHPTCTH-UHFFFAOYSA-N.
| Molecular formula | C18H18FNO |
|---|---|
| Molecular weight | 283.3 g/mol |
| IUPAC name | N-(4-fluorophenyl)-1-phenylcyclopentane-1-carboxamide |
| InChIKey | QWPHKKNXHPTCTH-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=CC=CC=C2)C(=O)NC3=CC=C(C=C3)F |
Computed by PubChem (NCBI)