CAS 51299-97-9 is the registry number for 2-Isobutyryldimedone. Offered by: TRC. Available pack sizes: 1g.
5,5-dimethyl-2-(2-methylpropanoyl)cyclohexane-1,3-dione (CAS 51299-97-9) is a chemical compound with the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. IUPAC name: 5,5-dimethyl-2-(2-methylpropanoyl)cyclohexane-1,3-dione. InChIKey: LMAJWYLSIJKMLA-UHFFFAOYSA-N.
| Molecular formula | C12H18O3 |
|---|---|
| Molecular weight | 210.27 g/mol |
| IUPAC name | 5,5-dimethyl-2-(2-methylpropanoyl)cyclohexane-1,3-dione |
| InChIKey | LMAJWYLSIJKMLA-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)C1C(=O)CC(CC1=O)(C)C |
Computed by PubChem (NCBI)