CAS 51323-05-8 appears in our catalog under these names: Tizanidine EP Impurity B, N-(5-Chloro-2,1,3-benzothiadiazol-4-yl)-thiourea, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg, 50mg.
(5-chloro-2,1,3-benzothiadiazol-4-yl)thiourea (CAS 51323-05-8) is a chemical compound with the molecular formula C7H5ClN4S2 and a molecular weight of 244.7 g/mol. IUPAC name: (5-chloro-2,1,3-benzothiadiazol-4-yl)thiourea. InChIKey: HDSZYIYKDOIGFC-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN4S2 |
|---|---|
| Molecular weight | 244.7 g/mol |
| IUPAC name | (5-chloro-2,1,3-benzothiadiazol-4-yl)thiourea |
| InChIKey | HDSZYIYKDOIGFC-UHFFFAOYSA-N |
| SMILES | C1=CC2=NSN=C2C(=C1Cl)NC(=S)N |
Computed by PubChem (NCBI)