CAS 5142-75-6 appears in our catalog under these names: Tri-p-tolylbismuthine, 95%, Tri-p-tolylbismuthine, 98%, Tri–p–tolylbismuthine. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 250mg.
Tris(4-methylphenyl)bismuthane (CAS 5142-75-6) is a chemical compound with the molecular formula C21H21Bi and a molecular weight of 482.4 g/mol. IUPAC name: tris(4-methylphenyl)bismuthane. InChIKey: XIECNHSGPKDTNW-UHFFFAOYSA-N.
| Molecular formula | C21H21Bi |
|---|---|
| Molecular weight | 482.4 g/mol |
| IUPAC name | tris(4-methylphenyl)bismuthane |
| InChIKey | XIECNHSGPKDTNW-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)[Bi](C2=CC=C(C=C2)C)C3=CC=C(C=C3)C |
Computed by PubChem (NCBI)