CAS 514212-83-0 appears in our catalog under these names: Psilocin O-Glucuronide, Psilocin O-Glucuronide, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 0,5mg, 2,5mg, 5mg.
(2S,3S,4S,5R,6S)-6-[[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl]oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid (CAS 514212-83-0) is a chemical compound with the molecular formula C18H24N2O7 and a molecular weight of 380.4 g/mol. IUPAC name: (2S,3S,4S,5R,6S)-6-[[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl]oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid. InChIKey: QPZFVYCQQOLROG-RNGZQALNSA-N.
| Molecular formula | C18H24N2O7 |
|---|---|
| Molecular weight | 380.4 g/mol |
| IUPAC name | (2S,3S,4S,5R,6S)-6-[[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl]oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| InChIKey | QPZFVYCQQOLROG-RNGZQALNSA-N |
| SMILES | CN(C)CCC1=CNC2=C1C(=CC=C2)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)C(=O)O)O)O)O |
Computed by PubChem (NCBI)