CAS 51496-03-8 is the registry number for Sofosbuvir Impurity 80. Offered by: Chemat Brand. Available pack sizes: on request.
[2,3-di(propan-2-yl)phenyl] dihydrogen phosphate (CAS 51496-03-8) is a chemical compound with the molecular formula C12H19O4P and a molecular weight of 258.25 g/mol. IUPAC name: [2,3-di(propan-2-yl)phenyl] dihydrogen phosphate. InChIKey: SFFTXLYPBWITRH-UHFFFAOYSA-N.
| Molecular formula | C12H19O4P |
|---|---|
| Molecular weight | 258.25 g/mol |
| IUPAC name | [2,3-di(propan-2-yl)phenyl] dihydrogen phosphate |
| InChIKey | SFFTXLYPBWITRH-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=CC=C1)OP(=O)(O)O)C(C)C |
Computed by PubChem (NCBI)