Products 51496-03-8

CAS 51496-03-8 is the registry number for Sofosbuvir Impurity 80. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

[2,3-di(propan-2-yl)phenyl] dihydrogen phosphate (CAS 51496-03-8) is a chemical compound with the molecular formula C12H19O4P and a molecular weight of 258.25 g/mol. IUPAC name: [2,3-di(propan-2-yl)phenyl] dihydrogen phosphate. InChIKey: SFFTXLYPBWITRH-UHFFFAOYSA-N.

Identity
Molecular formulaC12H19O4P
Molecular weight258.25 g/mol
IUPAC name[2,3-di(propan-2-yl)phenyl] dihydrogen phosphate
InChIKeySFFTXLYPBWITRH-UHFFFAOYSA-N
SMILESCC(C)C1=C(C(=CC=C1)OP(=O)(O)O)C(C)C

Computed by PubChem (NCBI)