CAS 515-44-6 is the registry number for 4-Hydroxy-3,5-diiodobenzenesufonic Acid Sodium Salt Hydrate, >95%. Offered by: TRC. Available pack sizes: 2,5g, 250mg.
Sodium 4-hydroxy-3,5-diiodobenzenesulfonate (CAS 515-44-6) is a chemical compound with the molecular formula C6H3I2NaO4S and a molecular weight of 447.95 g/mol. IUPAC name: sodium 4-hydroxy-3,5-diiodobenzenesulfonate. InChIKey: OOYFHBACQBVLGC-UHFFFAOYSA-M.
| Molecular formula | C6H3I2NaO4S |
|---|---|
| Molecular weight | 447.95 g/mol |
| IUPAC name | sodium 4-hydroxy-3,5-diiodobenzenesulfonate |
| InChIKey | OOYFHBACQBVLGC-UHFFFAOYSA-M |
| SMILES | C1=C(C=C(C(=C1I)O)I)S(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)