CAS 515-57-1 is the registry number for maleylsulfathiazole. Offered by: GLPBio, MedChemExpress. Available pack sizes: 25mg, Get quote.
(Z)-4-oxo-4-[4-(1,3-thiazol-2-ylsulfamoyl)anilino]but-2-enoic acid (CAS 515-57-1) is a chemical compound with the molecular formula C13H11N3O5S2 and a molecular weight of 353.4 g/mol. IUPAC name: (Z)-4-oxo-4-[4-(1,3-thiazol-2-ylsulfamoyl)anilino]but-2-enoic acid. InChIKey: ALXRUJOUFGNSHT-WAYWQWQTSA-N.
| Molecular formula | C13H11N3O5S2 |
|---|---|
| Molecular weight | 353.4 g/mol |
| IUPAC name | (Z)-4-oxo-4-[4-(1,3-thiazol-2-ylsulfamoyl)anilino]but-2-enoic acid |
| InChIKey | ALXRUJOUFGNSHT-WAYWQWQTSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)/C=C\C(=O)O)S(=O)(=O)NC2=NC=CS2 |
Computed by PubChem (NCBI)