Products 51507-96-1
CAS 51507-96-1 is the registry number for L-Cystine N-carboxyanhydride. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[[(2,5-dioxo-1,3-oxazolidin-4-yl)methyldisulfanyl]methyl]-1,3-oxazolidine-2,5-dione (CAS 51507-96-1) is a chemical compound with the molecular formula C8H8N2O6S2 and a molecular weight of 292.3 g/mol. IUPAC name: 4-[[(2,5-dioxo-1,3-oxazolidin-4-yl)methyldisulfanyl]methyl]-1,3-oxazolidine-2,5-dione. InChIKey: AJOSXZJYTSNNSS-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O6S2 |
|---|---|
| Molecular weight | 292.3 g/mol |
| IUPAC name | 4-[[(2,5-dioxo-1,3-oxazolidin-4-yl)methyldisulfanyl]methyl]-1,3-oxazolidine-2,5-dione |
| InChIKey | AJOSXZJYTSNNSS-UHFFFAOYSA-N |
| SMILES | C(C1C(=O)OC(=O)N1)SSCC2C(=O)OC(=O)N2 |
Computed by PubChem (NCBI)
Synonyms:
L-Cystine N-carboxyanhydride