CAS 515179-33-6 is the registry number for (S)-2-Chloro-1-(pyridin-3-yl)ethan-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-2-chloro-1-pyridin-3-ylethanol (CAS 515179-33-6) is a chemical compound with the molecular formula C7H8ClNO and a molecular weight of 157.60 g/mol. IUPAC name: (1S)-2-chloro-1-pyridin-3-ylethanol. InChIKey: LCBCRIBFOZSPJL-SSDOTTSWSA-N.
| Molecular formula | C7H8ClNO |
|---|---|
| Molecular weight | 157.60 g/mol |
| IUPAC name | (1S)-2-chloro-1-pyridin-3-ylethanol |
| InChIKey | LCBCRIBFOZSPJL-SSDOTTSWSA-N |
| SMILES | C1=CC(=CN=C1)[C@@H](CCl)O |
Computed by PubChem (NCBI)