CAS 51521-29-0 is the registry number for Pyrido(3,4-G)isoquinoline. Offered by: Biosynth. Available pack sizes: 50mg, 100mg.
Pyrido[3,4-g]isoquinoline (CAS 51521-29-0) is a chemical compound with the molecular formula C12H8N2 and a molecular weight of 180.20 g/mol. IUPAC name: pyrido[3,4-g]isoquinoline. InChIKey: CXKVSEWPNCOXRI-UHFFFAOYSA-N.
| Molecular formula | C12H8N2 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | pyrido[3,4-g]isoquinoline |
| InChIKey | CXKVSEWPNCOXRI-UHFFFAOYSA-N |
| SMILES | C1=CN=CC2=CC3=C(C=C21)C=NC=C3 |
Computed by PubChem (NCBI)