Products 51527-73-2

CAS 51527-73-2 appears in our catalog under these names: 2,4,6–Trichlorobenzenesulfonyl Chloride, 2,4,6-Trichlorobenzenesulfonyl chloride, 2,4,6-Trichlorobenzenesulfonyl Chloride, >98.0%(GC)(T), 2,4,6-Trichlorobenzene-1-sulfonyl chloride 98%, 2,4,6-Trichlorobenzenesulfonyl chloride, 96%. Offered by: GLPBio, Biosynth, TCI, Ambeed, Fluorochem. Available pack sizes: 25g, 5g, 0,25g, 2,5g, 1g, 10g.

Structural formula: {0} (CAS {1})

2,4,6-trichlorobenzenesulfonyl chloride (CAS 51527-73-2) is a chemical compound with the molecular formula C6H2Cl4O2S and a molecular weight of 280.0 g/mol. IUPAC name: 2,4,6-trichlorobenzenesulfonyl chloride. InChIKey: WHJAQKAAIOHCGN-UHFFFAOYSA-N.

Identity
Molecular formulaC6H2Cl4O2S
Molecular weight280.0 g/mol
IUPAC name2,4,6-trichlorobenzenesulfonyl chloride
InChIKeyWHJAQKAAIOHCGN-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1Cl)S(=O)(=O)Cl)Cl)Cl

Computed by PubChem (NCBI)