CAS 51527-73-2 appears in our catalog under these names: 2,4,6–Trichlorobenzenesulfonyl Chloride, 2,4,6-Trichlorobenzenesulfonyl chloride, 2,4,6-Trichlorobenzenesulfonyl Chloride, >98.0%(GC)(T), 2,4,6-Trichlorobenzene-1-sulfonyl chloride 98%, 2,4,6-Trichlorobenzenesulfonyl chloride, 96%. Offered by: GLPBio, Biosynth, TCI, Ambeed, Fluorochem. Available pack sizes: 25g, 5g, 0,25g, 2,5g, 1g, 10g.
2,4,6-trichlorobenzenesulfonyl chloride (CAS 51527-73-2) is a chemical compound with the molecular formula C6H2Cl4O2S and a molecular weight of 280.0 g/mol. IUPAC name: 2,4,6-trichlorobenzenesulfonyl chloride. InChIKey: WHJAQKAAIOHCGN-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl4O2S |
|---|---|
| Molecular weight | 280.0 g/mol |
| IUPAC name | 2,4,6-trichlorobenzenesulfonyl chloride |
| InChIKey | WHJAQKAAIOHCGN-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)S(=O)(=O)Cl)Cl)Cl |
Computed by PubChem (NCBI)