CAS 51547-09-2 is the registry number for (1R)-1-(3,4-Dihydroxyphenyl)-2-(methylamino)ethane-1-sulfonic Acid Sodium Salt. Offered by: TRC. Available pack sizes: 100mg.
Sodium (1R)-1-(3,4-dihydroxyphenyl)-2-(methylamino)ethanesulfonate (CAS 51547-09-2) is a chemical compound with the molecular formula C9H12NNaO5S and a molecular weight of 269.25 g/mol. IUPAC name: sodium (1R)-1-(3,4-dihydroxyphenyl)-2-(methylamino)ethanesulfonate. InChIKey: DULFHPQRIOCQCO-FVGYRXGTSA-M.
| Molecular formula | C9H12NNaO5S |
|---|---|
| Molecular weight | 269.25 g/mol |
| IUPAC name | sodium (1R)-1-(3,4-dihydroxyphenyl)-2-(methylamino)ethanesulfonate |
| InChIKey | DULFHPQRIOCQCO-FVGYRXGTSA-M |
| SMILES | CNC[C@@H](C1=CC(=C(C=C1)O)O)S(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)