Products 51549-33-8
CAS 51549-33-8 appears in our catalog under these names: 5'–O–TBDMS–dG, 5'-O-TBDMS-dG, 98.83%, 5'-O-TBDMS-dG, 98%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 10mM (in 1ml dmso), 50mg, 50 mg, 10mM/1mL, 250mg, 1g.
2-amino-9-[(2R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]-1H-purin-6-one (CAS 51549-33-8) is a chemical compound with the molecular formula C16H27N5O4Si and a molecular weight of 381.50 g/mol. IUPAC name: 2-amino-9-[(2R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]-1H-purin-6-one. InChIKey: SEYILVDPIQPEAP-HBNTYKKESA-N.
| Molecular formula | C16H27N5O4Si |
|---|---|
| Molecular weight | 381.50 g/mol |
| IUPAC name | 2-amino-9-[(2R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]-1H-purin-6-one |
| InChIKey | SEYILVDPIQPEAP-HBNTYKKESA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1[C@H](C[C@@H](O1)N2C=NC3=C2N=C(NC3=O)N)O |
Computed by PubChem (NCBI)