CAS 51549-58-7 is the registry number for (2R,3S,5R)-5-(2-Amino-6-oxo-3,6-dihydro-9H-purin-9-yl)-2-(hydroxymethyl)tetrahydrofuran-3-yl acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,3S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] acetate (CAS 51549-58-7) is a chemical compound with the molecular formula C12H15N5O5 and a molecular weight of 309.28 g/mol. IUPAC name: [(2R,3S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] acetate. InChIKey: DMUSQTJZYXWEJL-XLPZGREQSA-N.
| Molecular formula | C12H15N5O5 |
|---|---|
| Molecular weight | 309.28 g/mol |
| IUPAC name | [(2R,3S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] acetate |
| InChIKey | DMUSQTJZYXWEJL-XLPZGREQSA-N |
| SMILES | CC(=O)O[C@H]1C[C@@H](O[C@@H]1CO)N2C=NC3=C2N=C(NC3=O)N |
Computed by PubChem (NCBI)