Products 91702-60-2
CAS 91702-60-2 appears in our catalog under these names: 2-Acetamido-7-((2-(acetyloxy)ethoxy)methyl)-6,7-dihydro-1H-purin-6-one, 2-((2-Acetamido-6-oxo-1H-purin-7(6H)-yl)methoxy)ethyl acetate, 97%, Acyclovir EP Impurity M, Aciclovir (Acyclovir) EP Impurity M, Acyclovir Impurity 5（Acyclovir EP Impurity M）. Offered by: Biosynth, Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: 50mg, 25mg, 100mg, 250mg, on request, 10mg, 200mg.
2-[(2-acetamido-6-oxo-1H-purin-7-yl)methoxy]ethyl acetate (CAS 91702-60-2) is a chemical compound with the molecular formula C12H15N5O5 and a molecular weight of 309.28 g/mol. IUPAC name: 2-[(2-acetamido-6-oxo-1H-purin-7-yl)methoxy]ethyl acetate. InChIKey: SJBOYFXLWONEHK-UHFFFAOYSA-N.
| Molecular formula | C12H15N5O5 |
|---|---|
| Molecular weight | 309.28 g/mol |
| IUPAC name | 2-[(2-acetamido-6-oxo-1H-purin-7-yl)methoxy]ethyl acetate |
| InChIKey | SJBOYFXLWONEHK-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=NC2=C(C(=O)N1)N(C=N2)COCCOC(=O)C |
Computed by PubChem (NCBI)
Synonyms:
2-((2-Acetamido-6-oxo-1H-purin-7(6H)-yl)methoxy)ethyl acetate, ACICLOVIR IMPURITY M [WHO-IP], ACICLOVIR IMPURITY M [EP IMPURITY], 2-((2-Acetamido-6-oxo-1H-purin-7(6H)-yl)methoxyethyl acetate, ACICLOVIR IMPURITY M (EP IMPURITY), ACICLOVIR IMPURITY M, N,O-Diacetate Isoacyclovir, Aciclovir EP Impurity M, 2-[(2-acetamido-6-oxo-3H-purin-7-yl)methoxy]ethyl acetate, Acyclovir Impurity M